D-glutamic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

(2R)-2-aminopentanedioic acid; D-glutamic acid
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS RN:[6893-26-1]
Formula:C5H9NO4; 147.13 g/mol
InChiKey:WHUUTDBJXJRKMK-GSVOUGTGSA-N
SMILES:N[C@H](CCC(O)=O)C(O)=O
Molecular structure of D-glutamic acid
Density:1.460 g/mL
Molar volume:100.8 mL/mol
Melting point:201 °C
Log10 partition octanol / water:-3.69

Isomers

2-(aminomethyl)butanedioic acid
Molecular structure of 2-(aminomethyl)butanedioic acid
2-aminopentanedioic acid
Molecular structure of 2-aminopentanedioic acid
3-azahexanedioic acid
Molecular structure of 3-azahexanedioic acid
2-(ethoxycarbonylamino)acetic acid
Molecular structure of 2-(ethoxycarbonylamino)acetic acid
ethyl 2-nitropropionate
Molecular structure of ethyl 2-nitropropionate
D-glutamic acid
Molecular structure of D-glutamic acid
glutamic acid
Molecular structure of glutamic acid
N-methylaspartic acid
Molecular structure of N-methylaspartic acid
N-methyliminodiacetic acid
Molecular structure of N-methyliminodiacetic acid
methyl 4-nitrobutanoate
Molecular structure of methyl 4-nitrobutanoate
  ::